C21H17FO4 — CID 7759087
(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 2-(4-fluorophenyl)acetate (PubChem CID 7759087) has the molecular formula C21H17FO4 and a molecular weight of 352.36 g/mol. Its IUPAC name is (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 2-(4-fluorophenyl)acetate.
| Compound Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 2-(4-fluorophenyl)acetate |
|---|---|
| PubChem CID | 7759087 |
| Molecular Formula | C21H17FO4 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 2-(4-fluorophenyl)acetate |
| SMILES | O=C(Cc1ccc(F)cc1)OCc1cc(=O)oc2cc3c(cc12)CCC3 |
| InChI | InChI=1S/C21H17FO4/c22-17-6-4-13(5-7-17)8-20(23)25-12-16-11-21(24)26-19-10-15-3-1-2-14(15)9-18(16)19/h4-7,9-11H,1-3,8,12H2 |
| InChIKey | IMJUNCABQOORGZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|