C26H22FNO5S — CID 2496023
(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl (3S,7aR)-7a-(4-fluorophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 2496023) has the molecular formula C26H22FNO5S and a molecular weight of 479.53 g/mol. Its IUPAC name is (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl (3S,7aR)-7a-(4-fluorophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl (3S,7aR)-7a-(4-fluorophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 2496023 |
| Molecular Formula | C26H22FNO5S |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl (3S,7aR)-7a-(4-fluorophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | O=C(OCc1cc(=O)oc2cc3c(cc12)CCC3)[C@H]1CS[C@@]2(c3ccc(F)cc3)CCC(=O)N12 |
| InChI | InChI=1S/C26H22FNO5S/c27-19-6-4-18(5-7-19)26-9-8-23(29)28(26)21(14-34-26)25(31)32-13-17-12-24(30)33-22-11-16-3-1-2-15(16)10-20(17)22/h4-7,10-12,21H,1-3,8-9,13-14H2/t21-,26-/m1/s1 |
| InChIKey | XUDIBKLJLGKZCZ-QFQXNSOFSA-N |
| XLogP | 4.05 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|