C20H18FNO3S — CID 7979281
(2-fluorophenyl)methyl (3S,7aS)-5-oxo-7a-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 7979281) has the molecular formula C20H18FNO3S and a molecular weight of 371.43 g/mol. Its IUPAC name is (2-fluorophenyl)methyl (3S,7aS)-5-oxo-7a-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | (2-fluorophenyl)methyl (3S,7aS)-5-oxo-7a-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 7979281 |
| Molecular Formula | C20H18FNO3S |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | (2-fluorophenyl)methyl (3S,7aS)-5-oxo-7a-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | O=C(OCc1ccccc1F)[C@H]1CS[C@]2(c3ccccc3)CCC(=O)N12 |
| InChI | InChI=1S/C20H18FNO3S/c21-16-9-5-4-6-14(16)12-25-19(24)17-13-26-20(11-10-18(23)22(17)20)15-7-2-1-3-8-15/h1-9,17H,10-13H2/t17-,20+/m1/s1 |
| InChIKey | SXHUWZJYKSAYIE-XLIONFOSSA-N |
| XLogP | 3.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |