C24H25NO4S — CID 7978865
[2-oxo-2-(2,4,6-trimethylphenyl)ethyl] (3S,7aS)-5-oxo-7a-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 7978865) has the molecular formula C24H25NO4S and a molecular weight of 423.53 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-trimethylphenyl)ethyl] (3S,7aS)-5-oxo-7a-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | [2-oxo-2-(2,4,6-trimethylphenyl)ethyl] (3S,7aS)-5-oxo-7a-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 7978865 |
| Molecular Formula | C24H25NO4S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | [2-oxo-2-(2,4,6-trimethylphenyl)ethyl] (3S,7aS)-5-oxo-7a-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | Cc1cc(C)c(C(=O)COC(=O)[C@H]2CS[C@]3(c4ccccc4)CCC(=O)N23)c(C)c1 |
| InChI | InChI=1S/C24H25NO4S/c1-15-11-16(2)22(17(3)12-15)20(26)13-29-23(28)19-14-30-24(10-9-21(27)25(19)24)18-7-5-4-6-8-18/h4-8,11-12,19H,9-10,13-14H2,1-3H3/t19-,24+/m1/s1 |
| InChIKey | SJWMBNUGUULBSP-DVECYGJZSA-N |
| XLogP | 3.93 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |