C24H24FNO4S — CID 4876262
[2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 7a-(4-fluorophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 4876262) has the molecular formula C24H24FNO4S and a molecular weight of 441.52 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 7a-(4-fluorophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 7a-(4-fluorophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 4876262 |
| Molecular Formula | C24H24FNO4S |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 7a-(4-fluorophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | Cc1cc(C)c(C(=O)COC(=O)C2CSC3(c4ccc(F)cc4)CCC(=O)N23)cc1C |
| InChI | InChI=1S/C24H24FNO4S/c1-14-10-16(3)19(11-15(14)2)21(27)12-30-23(29)20-13-31-24(9-8-22(28)26(20)24)17-4-6-18(25)7-5-17/h4-7,10-11,20H,8-9,12-13H2,1-3H3 |
| InChIKey | MJMJSHFGNHYXKL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |