C22H21FN2O5S — CID 2511850
[2-(2-methoxyanilino)-2-oxoethyl] (3S,7aS)-7a-(4-fluorophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 2511850) has the molecular formula C22H21FN2O5S and a molecular weight of 444.48 g/mol. Its IUPAC name is [2-(2-methoxyanilino)-2-oxoethyl] (3S,7aS)-7a-(4-fluorophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | [2-(2-methoxyanilino)-2-oxoethyl] (3S,7aS)-7a-(4-fluorophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 2511850 |
| Molecular Formula | C22H21FN2O5S |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | [2-(2-methoxyanilino)-2-oxoethyl] (3S,7aS)-7a-(4-fluorophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | COc1ccccc1NC(=O)COC(=O)[C@H]1CS[C@]2(c3ccc(F)cc3)CCC(=O)N12 |
| InChI | InChI=1S/C22H21FN2O5S/c1-29-18-5-3-2-4-16(18)24-19(26)12-30-21(28)17-13-31-22(11-10-20(27)25(17)22)14-6-8-15(23)9-7-14/h2-9,17H,10-13H2,1H3,(H,24,26)/t17-,22+/m1/s1 |
| InChIKey | DPZBLFMFIVIRJQ-VGSWGCGISA-N |
| XLogP | 2.91 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |