C20H17ClFN3O4S — CID 2459598
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] (3R,7aR)-7a-(4-fluorophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 2459598) has the molecular formula C20H17ClFN3O4S and a molecular weight of 449.89 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] (3R,7aR)-7a-(4-fluorophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] (3R,7aR)-7a-(4-fluorophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 2459598 |
| Molecular Formula | C20H17ClFN3O4S |
| Molecular Weight | 449.89 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] (3R,7aR)-7a-(4-fluorophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | O=C(COC(=O)[C@@H]1CS[C@@]2(c3ccc(F)cc3)CCC(=O)N12)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C20H17ClFN3O4S/c21-13-3-6-16(23-9-13)24-17(26)10-29-19(28)15-11-30-20(8-7-18(27)25(15)20)12-1-4-14(22)5-2-12/h1-6,9,15H,7-8,10-11H2,(H,23,24,26)/t15-,20+/m0/s1 |
| InChIKey | FRCFJKRLHOOYTB-MGPUTAFESA-N |
| XLogP | 2.95 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.89 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |