C21H17FN4O4S — CID 2482390
(4-oxo-1,2,3-benzotriazin-3-yl)methyl (3S,7aS)-7a-(4-fluorophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 2482390) has the molecular formula C21H17FN4O4S and a molecular weight of 440.46 g/mol. Its IUPAC name is (4-oxo-1,2,3-benzotriazin-3-yl)methyl (3S,7aS)-7a-(4-fluorophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl (3S,7aS)-7a-(4-fluorophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 2482390 |
| Molecular Formula | C21H17FN4O4S |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl (3S,7aS)-7a-(4-fluorophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | O=C(OCn1nnc2ccccc2c1=O)[C@H]1CS[C@]2(c3ccc(F)cc3)CCC(=O)N12 |
| InChI | InChI=1S/C21H17FN4O4S/c22-14-7-5-13(6-8-14)21-10-9-18(27)26(21)17(11-31-21)20(29)30-12-25-19(28)15-3-1-2-4-16(15)23-24-25/h1-8,17H,9-12H2/t17-,21+/m1/s1 |
| InChIKey | HABPQXWOQSAPIF-UTKZUKDTSA-N |
| XLogP | 2.02 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |