C17H12FN3O3 — CID 4023290
(4-oxo-1,2,3-benzotriazin-3-yl)methyl 3-(4-fluorophenyl)prop-2-enoate (PubChem CID 4023290) has the molecular formula C17H12FN3O3 and a molecular weight of 325.30 g/mol. Its IUPAC name is (4-oxo-1,2,3-benzotriazin-3-yl)methyl 3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4023290 |
| Molecular Formula | C17H12FN3O3 |
| Molecular Weight | 325.30 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 3-(4-fluorophenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(F)cc1)OCn1nnc2ccccc2c1=O |
| InChI | InChI=1S/C17H12FN3O3/c18-13-8-5-12(6-9-13)7-10-16(22)24-11-21-17(23)14-3-1-2-4-15(14)19-20-21/h1-10H,11H2 |
| InChIKey | XEVJMBTUIXHJLX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|