C16H13N3O4 — CID 4019555
(4-oxo-1,2,3-benzotriazin-3-yl)methyl 3-(5-methylfuran-2-yl)prop-2-enoate (PubChem CID 4019555) has the molecular formula C16H13N3O4 and a molecular weight of 311.30 g/mol. Its IUPAC name is (4-oxo-1,2,3-benzotriazin-3-yl)methyl 3-(5-methylfuran-2-yl)prop-2-enoate.
| Compound Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 3-(5-methylfuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 4019555 |
| Molecular Formula | C16H13N3O4 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 3-(5-methylfuran-2-yl)prop-2-enoate |
| SMILES | Cc1ccc(C=CC(=O)OCn2nnc3ccccc3c2=O)o1 |
| InChI | InChI=1S/C16H13N3O4/c1-11-6-7-12(23-11)8-9-15(20)22-10-19-16(21)13-4-2-3-5-14(13)17-18-19/h2-9H,10H2,1H3 |
| InChIKey | DPEKNGUVWQHDGY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 87.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|