C17H12N4O5 — CID 3325026
(4-oxo-1,2,3-benzotriazin-3-yl)methyl 3-(3-nitrophenyl)prop-2-enoate (PubChem CID 3325026) has the molecular formula C17H12N4O5 and a molecular weight of 352.31 g/mol. Its IUPAC name is (4-oxo-1,2,3-benzotriazin-3-yl)methyl 3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3325026 |
| Molecular Formula | C17H12N4O5 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 3-(3-nitrophenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1cccc([N+](=O)[O-])c1)OCn1nnc2ccccc2c1=O |
| InChI | InChI=1S/C17H12N4O5/c22-16(9-8-12-4-3-5-13(10-12)21(24)25)26-11-20-17(23)14-6-1-2-7-15(14)18-19-20/h1-10H,11H2 |
| InChIKey | NQRSCYJBAADVEW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 117.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|