C11H11N3O3 — CID 4524672
(4-oxo-1,2,3-benzotriazin-3-yl)methyl propanoate (PubChem CID 4524672) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is (4-oxo-1,2,3-benzotriazin-3-yl)methyl propanoate.
| Compound Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl propanoate |
|---|---|
| PubChem CID | 4524672 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl propanoate |
| SMILES | CCC(=O)OCn1nnc2ccccc2c1=O |
| InChI | InChI=1S/C11H11N3O3/c1-2-10(15)17-7-14-11(16)8-5-3-4-6-9(8)12-13-14/h3-6H,2,7H2,1H3 |
| InChIKey | VWEBAIZPADAJAB-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |