C21H15N3O3 — CID 7554658
(4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-phenylbenzoate (PubChem CID 7554658) has the molecular formula C21H15N3O3 and a molecular weight of 357.37 g/mol. Its IUPAC name is (4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-phenylbenzoate.
| Compound Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-phenylbenzoate |
|---|---|
| PubChem CID | 7554658 |
| Molecular Formula | C21H15N3O3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 2-phenylbenzoate |
| SMILES | O=C(OCn1nnc2ccccc2c1=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C21H15N3O3/c25-20-18-12-6-7-13-19(18)22-23-24(20)14-27-21(26)17-11-5-4-10-16(17)15-8-2-1-3-9-15/h1-13H,14H2 |
| InChIKey | ZCVMAOLCGGJJGF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |