C13H15N3O3 — CID 23770829
(4-oxo-1,2,3-benzotriazin-3-yl)methyl pentanoate (PubChem CID 23770829) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is (4-oxo-1,2,3-benzotriazin-3-yl)methyl pentanoate.
| Compound Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl pentanoate |
|---|---|
| PubChem CID | 23770829 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl pentanoate |
| SMILES | CCCCC(=O)OCn1nnc2ccccc2c1=O |
| InChI | InChI=1S/C13H15N3O3/c1-2-3-8-12(17)19-9-16-13(18)10-6-4-5-7-11(10)14-15-16/h4-7H,2-3,8-9H2,1H3 |
| InChIKey | IAJHPPCNVBWCMF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |