C24H18N4O5 — CID 4241901
(4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate (PubChem CID 4241901) has the molecular formula C24H18N4O5 and a molecular weight of 442.43 g/mol. Its IUPAC name is (4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate.
| Compound Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate |
|---|---|
| PubChem CID | 4241901 |
| Molecular Formula | C24H18N4O5 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate |
| SMILES | O=C(CCCN1C(=O)c2cccc3cccc(c23)C1=O)OCn1nnc2ccccc2c1=O |
| InChI | InChI=1S/C24H18N4O5/c29-20(33-14-28-24(32)16-8-1-2-11-19(16)25-26-28)12-5-13-27-22(30)17-9-3-6-15-7-4-10-18(21(15)17)23(27)31/h1-4,6-11H,5,12-14H2 |
| InChIKey | VHIPAENEEVBGCQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|