C24H20FNO5 — CID 3937660
2-(2-fluorophenoxy)ethyl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate (PubChem CID 3937660) has the molecular formula C24H20FNO5 and a molecular weight of 421.42 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)ethyl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate.
| Compound Name | 2-(2-fluorophenoxy)ethyl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate |
|---|---|
| PubChem CID | 3937660 |
| Molecular Formula | C24H20FNO5 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 2-(2-fluorophenoxy)ethyl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate |
| SMILES | O=C(CCCN1C(=O)c2cccc3cccc(c23)C1=O)OCCOc1ccccc1F |
| InChI | InChI=1S/C24H20FNO5/c25-19-10-1-2-11-20(19)30-14-15-31-21(27)12-5-13-26-23(28)17-8-3-6-16-7-4-9-18(22(16)17)24(26)29/h1-4,6-11H,5,12-15H2 |
| InChIKey | ZKYUVRQNUWFVNE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|