C22H24N2O5 — CID 4280885
[2-(2-methylpropylamino)-2-oxoethyl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate (PubChem CID 4280885) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is [2-(2-methylpropylamino)-2-oxoethyl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate.
| Compound Name | [2-(2-methylpropylamino)-2-oxoethyl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate |
|---|---|
| PubChem CID | 4280885 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | [2-(2-methylpropylamino)-2-oxoethyl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate |
| SMILES | CC(C)CNC(=O)COC(=O)CCCN1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C22H24N2O5/c1-14(2)12-23-18(25)13-29-19(26)10-5-11-24-21(27)16-8-3-6-15-7-4-9-17(20(15)16)22(24)28/h3-4,6-9,14H,5,10-13H2,1-2H3,(H,23,25) |
| InChIKey | PSYXIYBBTWLKNA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|