C20H24ClN3O3 — CID 119495415
N-(3-aminobutyl)-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanamide;hydrochloride (PubChem CID 119495415) has the molecular formula C20H24ClN3O3 and a molecular weight of 389.88 g/mol. Its IUPAC name is N-(3-aminobutyl)-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanamide;hydrochloride.
| Compound Name | N-(3-aminobutyl)-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119495415 |
| Molecular Formula | C20H24ClN3O3 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | N-(3-aminobutyl)-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanamide;hydrochloride |
| SMILES | CC(N)CCNC(=O)CCCN1C(=O)c2cccc3cccc(c23)C1=O.Cl |
| InChI | InChI=1S/C20H23N3O3.ClH/c1-13(21)10-11-22-17(24)9-4-12-23-19(25)15-7-2-5-14-6-3-8-16(18(14)15)20(23)26;/h2-3,5-8,13H,4,9-12,21H2,1H3,(H,22,24);1H |
| InChIKey | BKNBQRNJVLYKNX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|