C17H23N3O3 — CID 120562654
4-amino-N-[4-(1,3-dioxoisoindol-2-yl)butyl]pentanamide (PubChem CID 120562654) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 4-amino-N-[4-(1,3-dioxoisoindol-2-yl)butyl]pentanamide.
| Compound Name | 4-amino-N-[4-(1,3-dioxoisoindol-2-yl)butyl]pentanamide |
|---|---|
| PubChem CID | 120562654 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 4-amino-N-[4-(1,3-dioxoisoindol-2-yl)butyl]pentanamide |
| SMILES | CC(N)CCC(=O)NCCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H23N3O3/c1-12(18)8-9-15(21)19-10-4-5-11-20-16(22)13-6-2-3-7-14(13)17(20)23/h2-3,6-7,12H,4-5,8-11,18H2,1H3,(H,19,21) |
| InChIKey | CWMBXKKOIUBANH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|