C16H22ClN3O3 — CID 119323815
4-amino-N-[4-(1,3-dioxoisoindol-2-yl)butyl]butanamide;hydrochloride (PubChem CID 119323815) has the molecular formula C16H22ClN3O3 and a molecular weight of 339.82 g/mol. Its IUPAC name is 4-amino-N-[4-(1,3-dioxoisoindol-2-yl)butyl]butanamide;hydrochloride.
| Compound Name | 4-amino-N-[4-(1,3-dioxoisoindol-2-yl)butyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119323815 |
| Molecular Formula | C16H22ClN3O3 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 4-amino-N-[4-(1,3-dioxoisoindol-2-yl)butyl]butanamide;hydrochloride |
| SMILES | Cl.NCCCC(=O)NCCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H21N3O3.ClH/c17-9-5-8-14(20)18-10-3-4-11-19-15(21)12-6-1-2-7-13(12)16(19)22;/h1-2,6-7H,3-5,8-11,17H2,(H,18,20);1H |
| InChIKey | UGGRIDAIIZLCLQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|