C16H20N2O4 — CID 110417982
3-(1,3-dioxoisoindol-2-yl)-N-(4-methoxybutyl)propanamide (PubChem CID 110417982) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-(4-methoxybutyl)propanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-(4-methoxybutyl)propanamide |
|---|---|
| PubChem CID | 110417982 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-(4-methoxybutyl)propanamide |
| SMILES | COCCCCNC(=O)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H20N2O4/c1-22-11-5-4-9-17-14(19)8-10-18-15(20)12-6-2-3-7-13(12)16(18)21/h2-3,6-7H,4-5,8-11H2,1H3,(H,17,19) |
| InChIKey | AEFFUFPBGFYVTM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|