C15H19N3O4 — CID 108889356
1-[3-(1,3-dioxoisoindol-2-yl)propyl]-3-(2-methoxyethyl)urea (PubChem CID 108889356) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is 1-[3-(1,3-dioxoisoindol-2-yl)propyl]-3-(2-methoxyethyl)urea.
| Compound Name | 1-[3-(1,3-dioxoisoindol-2-yl)propyl]-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 108889356 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 1-[3-(1,3-dioxoisoindol-2-yl)propyl]-3-(2-methoxyethyl)urea |
| SMILES | COCCNC(=O)NCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H19N3O4/c1-22-10-8-17-15(21)16-7-4-9-18-13(19)11-5-2-3-6-12(11)14(18)20/h2-3,5-6H,4,7-10H2,1H3,(H2,16,17,21) |
| InChIKey | GWBVEMQFVDFMNE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|