C18H25N3O5 — CID 108889531
3-[3-(1,3-dioxoisoindol-2-yl)propyl]-1,1-bis(2-methoxyethyl)urea (PubChem CID 108889531) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is 3-[3-(1,3-dioxoisoindol-2-yl)propyl]-1,1-bis(2-methoxyethyl)urea.
| Compound Name | 3-[3-(1,3-dioxoisoindol-2-yl)propyl]-1,1-bis(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 108889531 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 3-[3-(1,3-dioxoisoindol-2-yl)propyl]-1,1-bis(2-methoxyethyl)urea |
| SMILES | COCCN(CCOC)C(=O)NCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H25N3O5/c1-25-12-10-20(11-13-26-2)18(24)19-8-5-9-21-16(22)14-6-3-4-7-15(14)17(21)23/h3-4,6-7H,5,8-13H2,1-2H3,(H,19,24) |
| InChIKey | ZZHDDEVZJGSPDV-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|