C19H25N3O3 — CID 108889348
1-cyclohexyl-3-[3-(1,3-dioxoisoindol-2-yl)propyl]-1-methylurea (PubChem CID 108889348) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 1-cyclohexyl-3-[3-(1,3-dioxoisoindol-2-yl)propyl]-1-methylurea.
| Compound Name | 1-cyclohexyl-3-[3-(1,3-dioxoisoindol-2-yl)propyl]-1-methylurea |
|---|---|
| PubChem CID | 108889348 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 1-cyclohexyl-3-[3-(1,3-dioxoisoindol-2-yl)propyl]-1-methylurea |
| SMILES | CN(C(=O)NCCCN1C(=O)c2ccccc2C1=O)C1CCCCC1 |
| InChI | InChI=1S/C19H25N3O3/c1-21(14-8-3-2-4-9-14)19(25)20-12-7-13-22-17(23)15-10-5-6-11-16(15)18(22)24/h5-6,10-11,14H,2-4,7-9,12-13H2,1H3,(H,20,25) |
| InChIKey | FVKNUTBYGBSEPO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|