C17H20N4O7S — CID 108890259
1-(1,1-dioxothiolan-3-yl)-1-methyl-3-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]urea (PubChem CID 108890259) has the molecular formula C17H20N4O7S and a molecular weight of 424.44 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-1-methyl-3-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]urea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-1-methyl-3-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]urea |
|---|---|
| PubChem CID | 108890259 |
| Molecular Formula | C17H20N4O7S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-1-methyl-3-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propyl]urea |
| SMILES | CN(C(=O)NCCCN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H20N4O7S/c1-19(12-5-8-29(27,28)10-12)17(24)18-6-2-7-20-15(22)13-4-3-11(21(25)26)9-14(13)16(20)23/h3-4,9,12H,2,5-8,10H2,1H3,(H,18,24) |
| InChIKey | RIVKZWAGOPARAC-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|