C20H24N4O7 — CID 108890094
ethyl 1-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propylcarbamoyl]piperidine-4-carboxylate (PubChem CID 108890094) has the molecular formula C20H24N4O7 and a molecular weight of 432.43 g/mol. Its IUPAC name is ethyl 1-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propylcarbamoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propylcarbamoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 108890094 |
| Molecular Formula | C20H24N4O7 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | ethyl 1-[3-(5-nitro-1,3-dioxoisoindol-2-yl)propylcarbamoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)NCCCN2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)CC1 |
| InChI | InChI=1S/C20H24N4O7/c1-2-31-19(27)13-6-10-22(11-7-13)20(28)21-8-3-9-23-17(25)15-5-4-14(24(29)30)12-16(15)18(23)26/h4-5,12-13H,2-3,6-11H2,1H3,(H,21,28) |
| InChIKey | UAGMTBHDYRINIT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|