C15H20ClN3O5S — CID 24682203
2-[(2-chloro-5-nitrophenyl)methyl-methylamino]-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide (PubChem CID 24682203) has the molecular formula C15H20ClN3O5S and a molecular weight of 389.86 g/mol. Its IUPAC name is 2-[(2-chloro-5-nitrophenyl)methyl-methylamino]-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide.
| Compound Name | 2-[(2-chloro-5-nitrophenyl)methyl-methylamino]-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 24682203 |
| Molecular Formula | C15H20ClN3O5S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 2-[(2-chloro-5-nitrophenyl)methyl-methylamino]-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide |
| SMILES | CN(CC(=O)N(C)C1CCS(=O)(=O)C1)Cc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C15H20ClN3O5S/c1-17(8-11-7-12(19(21)22)3-4-14(11)16)9-15(20)18(2)13-5-6-25(23,24)10-13/h3-4,7,13H,5-6,8-10H2,1-2H3 |
| InChIKey | BDQLVUNBCNIAQU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|