C14H17ClN2O5S — CID 8501608
2-chloro-N-[(3R)-1,1-dioxothiolan-3-yl]-4-nitro-N-propylbenzamide (PubChem CID 8501608) has the molecular formula C14H17ClN2O5S and a molecular weight of 360.82 g/mol. Its IUPAC name is 2-chloro-N-[(3R)-1,1-dioxothiolan-3-yl]-4-nitro-N-propylbenzamide.
| Compound Name | 2-chloro-N-[(3R)-1,1-dioxothiolan-3-yl]-4-nitro-N-propylbenzamide |
|---|---|
| PubChem CID | 8501608 |
| Molecular Formula | C14H17ClN2O5S |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 2-chloro-N-[(3R)-1,1-dioxothiolan-3-yl]-4-nitro-N-propylbenzamide |
| SMILES | CCCN(C(=O)c1ccc([N+](=O)[O-])cc1Cl)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H17ClN2O5S/c1-2-6-16(11-5-7-23(21,22)9-11)14(18)12-4-3-10(17(19)20)8-13(12)15/h3-4,8,11H,2,5-7,9H2,1H3/t11-/m1/s1 |
| InChIKey | NITMMWFJWKCSPV-LLVKDONJSA-N |
| XLogP | 2.29 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|