C16H20N2O7S — CID 119179470
3-[butyl-(1,1-dioxothiolan-3-yl)carbamoyl]-5-nitrobenzoic acid (PubChem CID 119179470) has the molecular formula C16H20N2O7S and a molecular weight of 384.41 g/mol. Its IUPAC name is 3-[butyl-(1,1-dioxothiolan-3-yl)carbamoyl]-5-nitrobenzoic acid.
| Compound Name | 3-[butyl-(1,1-dioxothiolan-3-yl)carbamoyl]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 119179470 |
| Molecular Formula | C16H20N2O7S |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 3-[butyl-(1,1-dioxothiolan-3-yl)carbamoyl]-5-nitrobenzoic acid |
| SMILES | CCCCN(C(=O)c1cc(C(=O)O)cc([N+](=O)[O-])c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H20N2O7S/c1-2-3-5-17(13-4-6-26(24,25)10-13)15(19)11-7-12(16(20)21)9-14(8-11)18(22)23/h7-9,13H,2-6,10H2,1H3,(H,20,21) |
| InChIKey | QTWHGIXVLIWNRM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 134.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|