C16H20F3NO3S — CID 18573610
N-butyl-N-(1,1-dioxothiolan-3-yl)-3-(trifluoromethyl)benzamide (PubChem CID 18573610) has the molecular formula C16H20F3NO3S and a molecular weight of 363.40 g/mol. Its IUPAC name is N-butyl-N-(1,1-dioxothiolan-3-yl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 18573610 |
| Molecular Formula | C16H20F3NO3S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-3-(trifluoromethyl)benzamide |
| SMILES | CCCCN(C(=O)c1cccc(C(F)(F)F)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H20F3NO3S/c1-2-3-8-20(14-7-9-24(22,23)11-14)15(21)12-5-4-6-13(10-12)16(17,18)19/h4-6,10,14H,2-3,7-9,11H2,1H3 |
| InChIKey | WXDVULCKZYJDRI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |