C19H29FN2O5S2 — CID 55507710
N-butyl-3-(diethylsulfamoyl)-N-(1,1-dioxothiolan-3-yl)-4-fluorobenzamide (PubChem CID 55507710) has the molecular formula C19H29FN2O5S2 and a molecular weight of 448.58 g/mol. Its IUPAC name is N-butyl-3-(diethylsulfamoyl)-N-(1,1-dioxothiolan-3-yl)-4-fluorobenzamide.
| Compound Name | N-butyl-3-(diethylsulfamoyl)-N-(1,1-dioxothiolan-3-yl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 55507710 |
| Molecular Formula | C19H29FN2O5S2 |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | N-butyl-3-(diethylsulfamoyl)-N-(1,1-dioxothiolan-3-yl)-4-fluorobenzamide |
| SMILES | CCCCN(C(=O)c1ccc(F)c(S(=O)(=O)N(CC)CC)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H29FN2O5S2/c1-4-7-11-22(16-10-12-28(24,25)14-16)19(23)15-8-9-17(20)18(13-15)29(26,27)21(5-2)6-3/h8-9,13,16H,4-7,10-12,14H2,1-3H3 |
| InChIKey | FILRQFSQLPQJSK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |