C18H27FN2O5S2 — CID 55607998
N-butyl-N-(1,1-dioxothiolan-3-yl)-2-fluoro-5-(propan-2-ylsulfamoyl)benzamide (PubChem CID 55607998) has the molecular formula C18H27FN2O5S2 and a molecular weight of 434.56 g/mol. Its IUPAC name is N-butyl-N-(1,1-dioxothiolan-3-yl)-2-fluoro-5-(propan-2-ylsulfamoyl)benzamide.
| Compound Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-2-fluoro-5-(propan-2-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55607998 |
| Molecular Formula | C18H27FN2O5S2 |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-2-fluoro-5-(propan-2-ylsulfamoyl)benzamide |
| SMILES | CCCCN(C(=O)c1cc(S(=O)(=O)NC(C)C)ccc1F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H27FN2O5S2/c1-4-5-9-21(14-8-10-27(23,24)12-14)18(22)16-11-15(6-7-17(16)19)28(25,26)20-13(2)3/h6-7,11,13-14,20H,4-5,8-10,12H2,1-3H3 |
| InChIKey | WVLKVRFFZIVBLE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |