C22H28N2O5S2 — CID 55520088
N-butyl-N-(1,1-dioxothiolan-3-yl)-3-[(4-methylphenyl)sulfamoyl]benzamide (PubChem CID 55520088) has the molecular formula C22H28N2O5S2 and a molecular weight of 464.61 g/mol. Its IUPAC name is N-butyl-N-(1,1-dioxothiolan-3-yl)-3-[(4-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-3-[(4-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55520088 |
| Molecular Formula | C22H28N2O5S2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-3-[(4-methylphenyl)sulfamoyl]benzamide |
| SMILES | CCCCN(C(=O)c1cccc(S(=O)(=O)Nc2ccc(C)cc2)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H28N2O5S2/c1-3-4-13-24(20-12-14-30(26,27)16-20)22(25)18-6-5-7-21(15-18)31(28,29)23-19-10-8-17(2)9-11-19/h5-11,15,20,23H,3-4,12-14,16H2,1-2H3 |
| InChIKey | XIZRGAWLJQCETK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |