C20H26N2O6S2 — CID 55984401
N-butyl-N-(1,1-dioxothiolan-3-yl)-4-(furan-2-ylmethylsulfamoyl)benzamide (PubChem CID 55984401) has the molecular formula C20H26N2O6S2 and a molecular weight of 454.57 g/mol. Its IUPAC name is N-butyl-N-(1,1-dioxothiolan-3-yl)-4-(furan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-4-(furan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55984401 |
| Molecular Formula | C20H26N2O6S2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-4-(furan-2-ylmethylsulfamoyl)benzamide |
| SMILES | CCCCN(C(=O)c1ccc(S(=O)(=O)NCc2ccco2)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H26N2O6S2/c1-2-3-11-22(17-10-13-29(24,25)15-17)20(23)16-6-8-19(9-7-16)30(26,27)21-14-18-5-4-12-28-18/h4-9,12,17,21H,2-3,10-11,13-15H2,1H3 |
| InChIKey | OCWWIBMLNVNDSA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |