C15H18F3NO5S2 — CID 55573266
N-(1,1-dioxothiolan-3-yl)-N-propyl-4-(trifluoromethylsulfonyl)benzamide (PubChem CID 55573266) has the molecular formula C15H18F3NO5S2 and a molecular weight of 413.44 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-propyl-4-(trifluoromethylsulfonyl)benzamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-propyl-4-(trifluoromethylsulfonyl)benzamide |
|---|---|
| PubChem CID | 55573266 |
| Molecular Formula | C15H18F3NO5S2 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-propyl-4-(trifluoromethylsulfonyl)benzamide |
| SMILES | CCCN(C(=O)c1ccc(S(=O)(=O)C(F)(F)F)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H18F3NO5S2/c1-2-8-19(12-7-9-25(21,22)10-12)14(20)11-3-5-13(6-4-11)26(23,24)15(16,17)18/h3-6,12H,2,7-10H2,1H3 |
| InChIKey | FYSCKMJGZDHENJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |