C15H21NO4S — CID 102603881
N-butyl-N-(1,1-dioxothiolan-3-yl)-3-(furan-2-yl)prop-2-enamide (PubChem CID 102603881) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is N-butyl-N-(1,1-dioxothiolan-3-yl)-3-(furan-2-yl)prop-2-enamide.
| Compound Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 102603881 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-3-(furan-2-yl)prop-2-enamide |
| SMILES | CCCCN(C(=O)C=Cc1ccco1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H21NO4S/c1-2-3-9-16(13-8-11-21(18,19)12-13)15(17)7-6-14-5-4-10-20-14/h4-7,10,13H,2-3,8-9,11-12H2,1H3 |
| InChIKey | ALKKTFOFICHDAS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|