C21H24ClNO3S2 — CID 76859178
N-butyl-3-[5-(4-chlorophenyl)thiophen-2-yl]-N-(1,1-dioxothiolan-3-yl)prop-2-enamide (PubChem CID 76859178) has the molecular formula C21H24ClNO3S2 and a molecular weight of 438.01 g/mol. Its IUPAC name is N-butyl-3-[5-(4-chlorophenyl)thiophen-2-yl]-N-(1,1-dioxothiolan-3-yl)prop-2-enamide.
| Compound Name | N-butyl-3-[5-(4-chlorophenyl)thiophen-2-yl]-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 76859178 |
| Molecular Formula | C21H24ClNO3S2 |
| Molecular Weight | 438.01 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | N-butyl-3-[5-(4-chlorophenyl)thiophen-2-yl]-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
| SMILES | CCCCN(C(=O)C=Cc1ccc(-c2ccc(Cl)cc2)s1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H24ClNO3S2/c1-2-3-13-23(18-12-14-28(25,26)15-18)21(24)11-9-19-8-10-20(27-19)16-4-6-17(22)7-5-16/h4-11,18H,2-3,12-15H2,1H3 |
| InChIKey | BSTFDIHIIDDXSB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.01 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|