C14H18BrNO3S2 — CID 74514886
3-(5-bromothiophen-2-yl)-N-(1,1-dioxothiolan-3-yl)-N-propylprop-2-enamide (PubChem CID 74514886) has the molecular formula C14H18BrNO3S2 and a molecular weight of 392.34 g/mol. Its IUPAC name is 3-(5-bromothiophen-2-yl)-N-(1,1-dioxothiolan-3-yl)-N-propylprop-2-enamide.
| Compound Name | 3-(5-bromothiophen-2-yl)-N-(1,1-dioxothiolan-3-yl)-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 74514886 |
| Molecular Formula | C14H18BrNO3S2 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 390.99 |
| IUPAC Name | 3-(5-bromothiophen-2-yl)-N-(1,1-dioxothiolan-3-yl)-N-propylprop-2-enamide |
| SMILES | CCCN(C(=O)C=Cc1ccc(Br)s1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H18BrNO3S2/c1-2-8-16(11-7-9-21(18,19)10-11)14(17)6-4-12-3-5-13(15)20-12/h3-6,11H,2,7-10H2,1H3 |
| InChIKey | LMKIJEZEVKWENJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|