C13H21NO3S — CID 97449842
(2Z,4E)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-propylhexa-2,4-dienamide (PubChem CID 97449842) has the molecular formula C13H21NO3S and a molecular weight of 271.38 g/mol. Its IUPAC name is (2Z,4E)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-propylhexa-2,4-dienamide.
| Compound Name | (2Z,4E)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-propylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 97449842 |
| Molecular Formula | C13H21NO3S |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (2Z,4E)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-propylhexa-2,4-dienamide |
| SMILES | C/C=C/C=C\C(=O)N(CCC)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H21NO3S/c1-3-5-6-7-13(15)14(9-4-2)12-8-10-18(16,17)11-12/h3,5-7,12H,4,8-11H2,1-2H3/b5-3+,7-6-/t12-/m1/s1 |
| InChIKey | PPZNNHLECWCHNH-CWOQAQHBSA-N |
| XLogP | 1.54 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|