C10H19NO4S — CID 95586858
N-[(3S)-1,1-dioxothiolan-3-yl]-2-methoxy-N-propylacetamide (PubChem CID 95586858) has the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-2-methoxy-N-propylacetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-methoxy-N-propylacetamide |
|---|---|
| PubChem CID | 95586858 |
| Molecular Formula | C10H19NO4S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-methoxy-N-propylacetamide |
| SMILES | CCCN(C(=O)COC)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H19NO4S/c1-3-5-11(10(12)7-15-2)9-4-6-16(13,14)8-9/h9H,3-8H2,1-2H3/t9-/m0/s1 |
| InChIKey | UXYCVABXQAEAHZ-VIFPVBQESA-N |
| XLogP | 0.06 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |