C12H23NO6S — CID 103606749
N-(1,1-dioxothiolan-3-yl)-2-(2-methoxyethoxy)-N-(2-methoxyethyl)acetamide (PubChem CID 103606749) has the molecular formula C12H23NO6S and a molecular weight of 309.38 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(2-methoxyethoxy)-N-(2-methoxyethyl)acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(2-methoxyethoxy)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 103606749 |
| Molecular Formula | C12H23NO6S |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(2-methoxyethoxy)-N-(2-methoxyethyl)acetamide |
| SMILES | COCCOCC(=O)N(CCOC)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H23NO6S/c1-17-5-4-13(11-3-8-20(15,16)10-11)12(14)9-19-7-6-18-2/h11H,3-10H2,1-2H3 |
| InChIKey | HXKLDXKYUQVMRO-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|