C10H18N2O5S — CID 108526153
N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)-N-methyloxamide (PubChem CID 108526153) has the molecular formula C10H18N2O5S and a molecular weight of 278.33 g/mol. Its IUPAC name is N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)-N-methyloxamide.
| Compound Name | N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)-N-methyloxamide |
|---|---|
| PubChem CID | 108526153 |
| Molecular Formula | C10H18N2O5S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)-N-methyloxamide |
| SMILES | CNC(=O)C(=O)N(CCOC)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H18N2O5S/c1-11-9(13)10(14)12(4-5-17-2)8-3-6-18(15,16)7-8/h8H,3-7H2,1-2H3,(H,11,13) |
| InChIKey | WFCRIHPKBDCNCM-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|