C17H24N2O5S — CID 108522298
N'-(1,1-dioxothiolan-3-yl)-N-(4-ethylphenyl)-N'-(2-methoxyethyl)oxamide (PubChem CID 108522298) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is N'-(1,1-dioxothiolan-3-yl)-N-(4-ethylphenyl)-N'-(2-methoxyethyl)oxamide.
| Compound Name | N'-(1,1-dioxothiolan-3-yl)-N-(4-ethylphenyl)-N'-(2-methoxyethyl)oxamide |
|---|---|
| PubChem CID | 108522298 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N'-(1,1-dioxothiolan-3-yl)-N-(4-ethylphenyl)-N'-(2-methoxyethyl)oxamide |
| SMILES | CCc1ccc(NC(=O)C(=O)N(CCOC)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C17H24N2O5S/c1-3-13-4-6-14(7-5-13)18-16(20)17(21)19(9-10-24-2)15-8-11-25(22,23)12-15/h4-7,15H,3,8-12H2,1-2H3,(H,18,20) |
| InChIKey | PLMCQPMHJZMKNU-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|