C17H25N3O5S — CID 108527257
N-[3-(dimethylamino)phenyl]-N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)oxamide (PubChem CID 108527257) has the molecular formula C17H25N3O5S and a molecular weight of 383.47 g/mol. Its IUPAC name is N-[3-(dimethylamino)phenyl]-N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)oxamide.
| Compound Name | N-[3-(dimethylamino)phenyl]-N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)oxamide |
|---|---|
| PubChem CID | 108527257 |
| Molecular Formula | C17H25N3O5S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-[3-(dimethylamino)phenyl]-N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)oxamide |
| SMILES | COCCN(C(=O)C(=O)Nc1cccc(N(C)C)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H25N3O5S/c1-19(2)14-6-4-5-13(11-14)18-16(21)17(22)20(8-9-25-3)15-7-10-26(23,24)12-15/h4-6,11,15H,7-10,12H2,1-3H3,(H,18,21) |
| InChIKey | WRAKVDWNYCOVHO-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|