C14H17BrN2O4S — CID 108526938
N-(3-bromophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-ethyloxamide (PubChem CID 108526938) has the molecular formula C14H17BrN2O4S and a molecular weight of 389.27 g/mol. Its IUPAC name is N-(3-bromophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-ethyloxamide.
| Compound Name | N-(3-bromophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-ethyloxamide |
|---|---|
| PubChem CID | 108526938 |
| Molecular Formula | C14H17BrN2O4S |
| Molecular Weight | 389.27 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | N-(3-bromophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-ethyloxamide |
| SMILES | CCN(C(=O)C(=O)Nc1cccc(Br)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H17BrN2O4S/c1-2-17(12-6-7-22(20,21)9-12)14(19)13(18)16-11-5-3-4-10(15)8-11/h3-5,8,12H,2,6-7,9H2,1H3,(H,16,18) |
| InChIKey | BQOXEACQQMAVRZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|