C16H16F6N2O4S — CID 108526948
N-[3,5-bis(trifluoromethyl)phenyl]-N'-(1,1-dioxothiolan-3-yl)-N'-ethyloxamide (PubChem CID 108526948) has the molecular formula C16H16F6N2O4S and a molecular weight of 446.37 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-N'-(1,1-dioxothiolan-3-yl)-N'-ethyloxamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-N'-(1,1-dioxothiolan-3-yl)-N'-ethyloxamide |
|---|---|
| PubChem CID | 108526948 |
| Molecular Formula | C16H16F6N2O4S |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-N'-(1,1-dioxothiolan-3-yl)-N'-ethyloxamide |
| SMILES | CCN(C(=O)C(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H16F6N2O4S/c1-2-24(12-3-4-29(27,28)8-12)14(26)13(25)23-11-6-9(15(17,18)19)5-10(7-11)16(20,21)22/h5-7,12H,2-4,8H2,1H3,(H,23,25) |
| InChIKey | HVQUMGIJGAUZFN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|