C18H26N2O6S — CID 108519884
N-(3,4-diethoxyphenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-ethyloxamide (PubChem CID 108519884) has the molecular formula C18H26N2O6S and a molecular weight of 398.48 g/mol. Its IUPAC name is N-(3,4-diethoxyphenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-ethyloxamide.
| Compound Name | N-(3,4-diethoxyphenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-ethyloxamide |
|---|---|
| PubChem CID | 108519884 |
| Molecular Formula | C18H26N2O6S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-(3,4-diethoxyphenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-ethyloxamide |
| SMILES | CCOc1ccc(NC(=O)C(=O)N(CC)C2CCS(=O)(=O)C2)cc1OCC |
| InChI | InChI=1S/C18H26N2O6S/c1-4-20(14-9-10-27(23,24)12-14)18(22)17(21)19-13-7-8-15(25-5-2)16(11-13)26-6-3/h7-8,11,14H,4-6,9-10,12H2,1-3H3,(H,19,21) |
| InChIKey | DEOZHAOSYMSETK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|