C19H28N2O5S — CID 108965272
N-(1,1-dioxothiolan-3-yl)-N'-(4-ethoxyphenyl)-N-ethyl-2,2-dimethylpropanediamide (PubChem CID 108965272) has the molecular formula C19H28N2O5S and a molecular weight of 396.51 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N'-(4-ethoxyphenyl)-N-ethyl-2,2-dimethylpropanediamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N'-(4-ethoxyphenyl)-N-ethyl-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108965272 |
| Molecular Formula | C19H28N2O5S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N'-(4-ethoxyphenyl)-N-ethyl-2,2-dimethylpropanediamide |
| SMILES | CCOc1ccc(NC(=O)C(C)(C)C(=O)N(CC)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C19H28N2O5S/c1-5-21(15-11-12-27(24,25)13-15)18(23)19(3,4)17(22)20-14-7-9-16(10-8-14)26-6-2/h7-10,15H,5-6,11-13H2,1-4H3,(H,20,22) |
| InChIKey | UMAKNJAOSLMUIT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|