C14H26N2O4S — CID 108957229
N-(1,1-dioxothiolan-3-yl)-N-ethyl-2,2-dimethyl-N'-propan-2-ylpropanediamide (PubChem CID 108957229) has the molecular formula C14H26N2O4S and a molecular weight of 318.44 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-ethyl-2,2-dimethyl-N'-propan-2-ylpropanediamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-2,2-dimethyl-N'-propan-2-ylpropanediamide |
|---|---|
| PubChem CID | 108957229 |
| Molecular Formula | C14H26N2O4S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-2,2-dimethyl-N'-propan-2-ylpropanediamide |
| SMILES | CCN(C(=O)C(C)(C)C(=O)NC(C)C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H26N2O4S/c1-6-16(11-7-8-21(19,20)9-11)13(18)14(4,5)12(17)15-10(2)3/h10-11H,6-9H2,1-5H3,(H,15,17) |
| InChIKey | ROOXVXCVIIHOLZ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|