C11H22N2O3S — CID 108989786
1-(1,1-dioxothiolan-3-yl)-1,3,3-triethylurea (PubChem CID 108989786) has the molecular formula C11H22N2O3S and a molecular weight of 262.37 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-1,3,3-triethylurea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-1,3,3-triethylurea |
|---|---|
| PubChem CID | 108989786 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-1,3,3-triethylurea |
| SMILES | CCN(CC)C(=O)N(CC)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H22N2O3S/c1-4-12(5-2)11(14)13(6-3)10-7-8-17(15,16)9-10/h10H,4-9H2,1-3H3 |
| InChIKey | QXDQSJOODJQQJF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |